C22H27N3O2 — CID 56902404
N-[(3-phenoxyphenyl)methyl]-2,8-diazaspiro[4.5]decane-3-carboxamide (PubChem CID 56902404) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is N-[(3-phenoxyphenyl)methyl]-2,8-diazaspiro[4.5]decane-3-carboxamide.
| Compound Name | N-[(3-phenoxyphenyl)methyl]-2,8-diazaspiro[4.5]decane-3-carboxamide |
|---|---|
| PubChem CID | 56902404 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | N-[(3-phenoxyphenyl)methyl]-2,8-diazaspiro[4.5]decane-3-carboxamide |
| SMILES | O=C(NCc1cccc(Oc2ccccc2)c1)C1CC2(CCNCC2)CN1 |
| InChI | InChI=1S/C22H27N3O2/c26-21(20-14-22(16-25-20)9-11-23-12-10-22)24-15-17-5-4-8-19(13-17)27-18-6-2-1-3-7-18/h1-8,13,20,23,25H,9-12,14-16H2,(H,24,26) |
| InChIKey | NBNVCHWLBXOANW-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |