C11H14N2O2S — CID 23462412
(3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methyl butanoate (PubChem CID 23462412) has the molecular formula C11H14N2O2S and a molecular weight of 238.31 g/mol. Its IUPAC name is (3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methyl butanoate.
| Compound Name | (3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methyl butanoate |
|---|---|
| PubChem CID | 23462412 |
| Molecular Formula | C11H14N2O2S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | (3-methylimidazo[2,1-b][1,3]thiazol-6-yl)methyl butanoate |
| SMILES | CCCC(=O)OCc1cn2c(C)csc2n1 |
| InChI | InChI=1S/C11H14N2O2S/c1-3-4-10(14)15-6-9-5-13-8(2)7-16-11(13)12-9/h5,7H,3-4,6H2,1-2H3 |
| InChIKey | LJUQLPMNRQUOOB-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |