C19H19N2O3S- — CID 7119142
(1S,6S)-6-[2-(2-phenyl-1,3-thiazol-4-yl)ethylcarbamoyl]cyclohex-3-ene-1-carboxylate (PubChem CID 7119142) has the molecular formula C19H19N2O3S- and a molecular weight of 355.44 g/mol. Its IUPAC name is (1S,6S)-6-[2-(2-phenyl-1,3-thiazol-4-yl)ethylcarbamoyl]cyclohex-3-ene-1-carboxylate.
| Compound Name | (1S,6S)-6-[2-(2-phenyl-1,3-thiazol-4-yl)ethylcarbamoyl]cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 7119142 |
| Molecular Formula | C19H19N2O3S- |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | (1S,6S)-6-[2-(2-phenyl-1,3-thiazol-4-yl)ethylcarbamoyl]cyclohex-3-ene-1-carboxylate |
| SMILES | O=C([O-])[C@H]1CC=CC[C@@H]1C(=O)NCCc1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C19H20N2O3S/c22-17(15-8-4-5-9-16(15)19(23)24)20-11-10-14-12-25-18(21-14)13-6-2-1-3-7-13/h1-7,12,15-16H,8-11H2,(H,20,22)(H,23,24)/p-1/t15-,16-/m0/s1 |
| InChIKey | AMCZBHHCVNIEHX-HOTGVXAUSA-M |
| XLogP | 1.80 |
| TPSA | 82.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|