C15H17N3OS — CID 51710217
1-cyclopropyl-3-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]urea (PubChem CID 51710217) has the molecular formula C15H17N3OS and a molecular weight of 287.39 g/mol. Its IUPAC name is 1-cyclopropyl-3-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]urea.
| Compound Name | 1-cyclopropyl-3-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]urea |
|---|---|
| PubChem CID | 51710217 |
| Molecular Formula | C15H17N3OS |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 1-cyclopropyl-3-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]urea |
| SMILES | O=C(NCCc1csc(-c2ccccc2)n1)NC1CC1 |
| InChI | InChI=1S/C15H17N3OS/c19-15(18-12-6-7-12)16-9-8-13-10-20-14(17-13)11-4-2-1-3-5-11/h1-5,10,12H,6-9H2,(H2,16,18,19) |
| InChIKey | LSAGNMWOHNBLNE-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |