C19H24N2S — CID 144959114
1-cyclohexyl-N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]ethenamine (PubChem CID 144959114) has the molecular formula C19H24N2S and a molecular weight of 312.48 g/mol. Its IUPAC name is 1-cyclohexyl-N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]ethenamine.
| Compound Name | 1-cyclohexyl-N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]ethenamine |
|---|---|
| PubChem CID | 144959114 |
| Molecular Formula | C19H24N2S |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 1-cyclohexyl-N-[2-(2-phenyl-1,3-thiazol-4-yl)ethyl]ethenamine |
| SMILES | C=C(NCCc1csc(-c2ccccc2)n1)C1CCCCC1 |
| InChI | InChI=1S/C19H24N2S/c1-15(16-8-4-2-5-9-16)20-13-12-18-14-22-19(21-18)17-10-6-3-7-11-17/h3,6-7,10-11,14,16,20H,1-2,4-5,8-9,12-13H2 |
| InChIKey | OPJCJLXDSVXDMQ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |