C18H18N4O3 — CID 97203237
4-(2,4-dioxoimidazolidin-1-yl)-N-[(2R)-1-pyridin-3-ylpropan-2-yl]benzamide (PubChem CID 97203237) has the molecular formula C18H18N4O3 and a molecular weight of 338.37 g/mol. Its IUPAC name is 4-(2,4-dioxoimidazolidin-1-yl)-N-[(2R)-1-pyridin-3-ylpropan-2-yl]benzamide.
| Compound Name | 4-(2,4-dioxoimidazolidin-1-yl)-N-[(2R)-1-pyridin-3-ylpropan-2-yl]benzamide |
|---|---|
| PubChem CID | 97203237 |
| Molecular Formula | C18H18N4O3 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 4-(2,4-dioxoimidazolidin-1-yl)-N-[(2R)-1-pyridin-3-ylpropan-2-yl]benzamide |
| SMILES | C[C@H](Cc1cccnc1)NC(=O)c1ccc(N2CC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C18H18N4O3/c1-12(9-13-3-2-8-19-10-13)20-17(24)14-4-6-15(7-5-14)22-11-16(23)21-18(22)25/h2-8,10,12H,9,11H2,1H3,(H,20,24)(H,21,23,25)/t12-/m1/s1 |
| InChIKey | HUBUMIDPMDVIAV-GFCCVEGCSA-N |
| XLogP | 1.50 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|