C14H17N3O3S — CID 110717829
N-[2-(2-amino-1,3-thiazol-4-yl)ethyl]-3,5-dimethoxybenzamide (PubChem CID 110717829) has the molecular formula C14H17N3O3S and a molecular weight of 307.38 g/mol. Its IUPAC name is N-[2-(2-amino-1,3-thiazol-4-yl)ethyl]-3,5-dimethoxybenzamide.
| Compound Name | N-[2-(2-amino-1,3-thiazol-4-yl)ethyl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 110717829 |
| Molecular Formula | C14H17N3O3S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | N-[2-(2-amino-1,3-thiazol-4-yl)ethyl]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)NCCc2csc(N)n2)c1 |
| InChI | InChI=1S/C14H17N3O3S/c1-19-11-5-9(6-12(7-11)20-2)13(18)16-4-3-10-8-21-14(15)17-10/h5-8H,3-4H2,1-2H3,(H2,15,17)(H,16,18) |
| InChIKey | LDJZNMWMKBOURQ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |