C9H16N4OS — CID 110747798
1-[2-(2-amino-1,3-thiazol-4-yl)ethyl]-3-propylurea (PubChem CID 110747798) has the molecular formula C9H16N4OS and a molecular weight of 228.32 g/mol. Its IUPAC name is 1-[2-(2-amino-1,3-thiazol-4-yl)ethyl]-3-propylurea.
| Compound Name | 1-[2-(2-amino-1,3-thiazol-4-yl)ethyl]-3-propylurea |
|---|---|
| PubChem CID | 110747798 |
| Molecular Formula | C9H16N4OS |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 1-[2-(2-amino-1,3-thiazol-4-yl)ethyl]-3-propylurea |
| SMILES | CCCNC(=O)NCCc1csc(N)n1 |
| InChI | InChI=1S/C9H16N4OS/c1-2-4-11-9(14)12-5-3-7-6-15-8(10)13-7/h6H,2-5H2,1H3,(H2,10,13)(H2,11,12,14) |
| InChIKey | GJXSGMOGUPYGNU-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |