C8H16N2S — CID 155733982
ethane;4-propyl-1,3-thiazol-2-amine (PubChem CID 155733982) has the molecular formula C8H16N2S and a molecular weight of 172.30 g/mol. Its IUPAC name is ethane;4-propyl-1,3-thiazol-2-amine.
| Compound Name | ethane;4-propyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 155733982 |
| Molecular Formula | C8H16N2S |
| Molecular Weight | 172.30 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | ethane;4-propyl-1,3-thiazol-2-amine |
| SMILES | CC.CCCc1csc(N)n1 |
| InChI | InChI=1S/C6H10N2S.C2H6/c1-2-3-5-4-9-6(7)8-5;1-2/h4H,2-3H2,1H3,(H2,7,8);1-2H3 |
| InChIKey | NJODZVXJGHMHRW-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.30 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |