C9H18N2S — CID 142312130
ethane;4-(2-methylpropyl)-1,3-thiazol-2-amine (PubChem CID 142312130) has the molecular formula C9H18N2S and a molecular weight of 186.32 g/mol. Its IUPAC name is ethane;4-(2-methylpropyl)-1,3-thiazol-2-amine.
| Compound Name | ethane;4-(2-methylpropyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 142312130 |
| Molecular Formula | C9H18N2S |
| Molecular Weight | 186.32 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | ethane;4-(2-methylpropyl)-1,3-thiazol-2-amine |
| SMILES | CC.CC(C)Cc1csc(N)n1 |
| InChI | InChI=1S/C7H12N2S.C2H6/c1-5(2)3-6-4-10-7(8)9-6;1-2/h4-5H,3H2,1-2H3,(H2,8,9);1-2H3 |
| InChIKey | QVHGGVFYDQASHB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.32 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |