C14H27N3S — CID 114011149
4-[[bis(3-methylbutyl)amino]methyl]-1,3-thiazol-2-amine (PubChem CID 114011149) has the molecular formula C14H27N3S and a molecular weight of 269.46 g/mol. Its IUPAC name is 4-[[bis(3-methylbutyl)amino]methyl]-1,3-thiazol-2-amine.
| Compound Name | 4-[[bis(3-methylbutyl)amino]methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 114011149 |
| Molecular Formula | C14H27N3S |
| Molecular Weight | 269.46 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | 4-[[bis(3-methylbutyl)amino]methyl]-1,3-thiazol-2-amine |
| SMILES | CC(C)CCN(CCC(C)C)Cc1csc(N)n1 |
| InChI | InChI=1S/C14H27N3S/c1-11(2)5-7-17(8-6-12(3)4)9-13-10-18-14(15)16-13/h10-12H,5-9H2,1-4H3,(H2,15,16) |
| InChIKey | YRBSLORTFSVQOK-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.46 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |