C10H19N3OS — CID 63697554
4-[[2-ethoxyethyl(ethyl)amino]methyl]-1,3-thiazol-2-amine (PubChem CID 63697554) has the molecular formula C10H19N3OS and a molecular weight of 229.35 g/mol. Its IUPAC name is 4-[[2-ethoxyethyl(ethyl)amino]methyl]-1,3-thiazol-2-amine.
| Compound Name | 4-[[2-ethoxyethyl(ethyl)amino]methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 63697554 |
| Molecular Formula | C10H19N3OS |
| Molecular Weight | 229.35 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | 4-[[2-ethoxyethyl(ethyl)amino]methyl]-1,3-thiazol-2-amine |
| SMILES | CCOCCN(CC)Cc1csc(N)n1 |
| InChI | InChI=1S/C10H19N3OS/c1-3-13(5-6-14-4-2)7-9-8-15-10(11)12-9/h8H,3-7H2,1-2H3,(H2,11,12) |
| InChIKey | LOKFXSONTXYOIY-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.35 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|