C13H23ClN2OS — CID 63690502
3-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(2-ethoxyethyl)-N-ethylpropan-1-amine (PubChem CID 63690502) has the molecular formula C13H23ClN2OS and a molecular weight of 290.86 g/mol. Its IUPAC name is 3-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(2-ethoxyethyl)-N-ethylpropan-1-amine.
| Compound Name | 3-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(2-ethoxyethyl)-N-ethylpropan-1-amine |
|---|---|
| PubChem CID | 63690502 |
| Molecular Formula | C13H23ClN2OS |
| Molecular Weight | 290.86 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 3-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(2-ethoxyethyl)-N-ethylpropan-1-amine |
| SMILES | CCOCCN(CC)CCCc1nc(CCl)cs1 |
| InChI | InChI=1S/C13H23ClN2OS/c1-3-16(8-9-17-4-2)7-5-6-13-15-12(10-14)11-18-13/h11H,3-10H2,1-2H3 |
| InChIKey | OEPPNAGRTLMUPZ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.86 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|