C14H23ClN2O3S — CID 82937845
2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N,N-bis(2-ethoxyethyl)acetamide (PubChem CID 82937845) has the molecular formula C14H23ClN2O3S and a molecular weight of 334.87 g/mol. Its IUPAC name is 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N,N-bis(2-ethoxyethyl)acetamide.
| Compound Name | 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N,N-bis(2-ethoxyethyl)acetamide |
|---|---|
| PubChem CID | 82937845 |
| Molecular Formula | C14H23ClN2O3S |
| Molecular Weight | 334.87 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N,N-bis(2-ethoxyethyl)acetamide |
| SMILES | CCOCCN(CCOCC)C(=O)Cc1nc(CCl)cs1 |
| InChI | InChI=1S/C14H23ClN2O3S/c1-3-19-7-5-17(6-8-20-4-2)14(18)9-13-16-12(10-15)11-21-13/h11H,3-10H2,1-2H3 |
| InChIKey | ADFDMNKDMYYGIO-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.87 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|