C14H15ClN2OS2 — CID 61439572
2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-cyclopropyl-N-(thiophen-3-ylmethyl)acetamide (PubChem CID 61439572) has the molecular formula C14H15ClN2OS2 and a molecular weight of 326.87 g/mol. Its IUPAC name is 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-cyclopropyl-N-(thiophen-3-ylmethyl)acetamide.
| Compound Name | 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-cyclopropyl-N-(thiophen-3-ylmethyl)acetamide |
|---|---|
| PubChem CID | 61439572 |
| Molecular Formula | C14H15ClN2OS2 |
| Molecular Weight | 326.87 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-cyclopropyl-N-(thiophen-3-ylmethyl)acetamide |
| SMILES | O=C(Cc1nc(CCl)cs1)N(Cc1ccsc1)C1CC1 |
| InChI | InChI=1S/C14H15ClN2OS2/c15-6-11-9-20-13(16-11)5-14(18)17(12-1-2-12)7-10-3-4-19-8-10/h3-4,8-9,12H,1-2,5-7H2 |
| InChIKey | XSMIAWMFKKDUBD-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.87 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|