C13H22ClN3OS — CID 103190292
2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-[1-(dimethylamino)propan-2-yl]-N-ethylacetamide (PubChem CID 103190292) has the molecular formula C13H22ClN3OS and a molecular weight of 303.86 g/mol. Its IUPAC name is 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-[1-(dimethylamino)propan-2-yl]-N-ethylacetamide.
| Compound Name | 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-[1-(dimethylamino)propan-2-yl]-N-ethylacetamide |
|---|---|
| PubChem CID | 103190292 |
| Molecular Formula | C13H22ClN3OS |
| Molecular Weight | 303.86 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-[1-(dimethylamino)propan-2-yl]-N-ethylacetamide |
| SMILES | CCN(C(=O)Cc1nc(CCl)cs1)C(C)CN(C)C |
| InChI | InChI=1S/C13H22ClN3OS/c1-5-17(10(2)8-16(3)4)13(18)6-12-15-11(7-14)9-19-12/h9-10H,5-8H2,1-4H3 |
| InChIKey | IHACRYAASBBYHK-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.86 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|