C9H15ClN2S — CID 43138343
N-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-N-methylpropan-2-amine (PubChem CID 43138343) has the molecular formula C9H15ClN2S and a molecular weight of 218.75 g/mol. Its IUPAC name is N-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-N-methylpropan-2-amine.
| Compound Name | N-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-N-methylpropan-2-amine |
|---|---|
| PubChem CID | 43138343 |
| Molecular Formula | C9H15ClN2S |
| Molecular Weight | 218.75 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | N-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-N-methylpropan-2-amine |
| SMILES | CC(C)N(C)Cc1nc(CCl)cs1 |
| InChI | InChI=1S/C9H15ClN2S/c1-7(2)12(3)5-9-11-8(4-10)6-13-9/h6-7H,4-5H2,1-3H3 |
| InChIKey | DLWPUSUMDNZMND-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.75 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|