C10H14ClF3N2S — CID 55008625
N-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-N-(2,2,2-trifluoroethyl)propan-2-amine (PubChem CID 55008625) has the molecular formula C10H14ClF3N2S and a molecular weight of 286.75 g/mol. Its IUPAC name is N-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-N-(2,2,2-trifluoroethyl)propan-2-amine.
| Compound Name | N-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-N-(2,2,2-trifluoroethyl)propan-2-amine |
|---|---|
| PubChem CID | 55008625 |
| Molecular Formula | C10H14ClF3N2S |
| Molecular Weight | 286.75 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | N-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-N-(2,2,2-trifluoroethyl)propan-2-amine |
| SMILES | CC(C)N(Cc1nc(CCl)cs1)CC(F)(F)F |
| InChI | InChI=1S/C10H14ClF3N2S/c1-7(2)16(6-10(12,13)14)4-9-15-8(3-11)5-17-9/h5,7H,3-4,6H2,1-2H3 |
| InChIKey | ZVFLTXDRCVAIKQ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.75 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|