C12H21ClN2OS — CID 54994016
3-[2-[4-(chloromethyl)-1,3-thiazol-2-yl]ethyl-propan-2-ylamino]propan-1-ol (PubChem CID 54994016) has the molecular formula C12H21ClN2OS and a molecular weight of 276.83 g/mol. Its IUPAC name is 3-[2-[4-(chloromethyl)-1,3-thiazol-2-yl]ethyl-propan-2-ylamino]propan-1-ol.
| Compound Name | 3-[2-[4-(chloromethyl)-1,3-thiazol-2-yl]ethyl-propan-2-ylamino]propan-1-ol |
|---|---|
| PubChem CID | 54994016 |
| Molecular Formula | C12H21ClN2OS |
| Molecular Weight | 276.83 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 3-[2-[4-(chloromethyl)-1,3-thiazol-2-yl]ethyl-propan-2-ylamino]propan-1-ol |
| SMILES | CC(C)N(CCCO)CCc1nc(CCl)cs1 |
| InChI | InChI=1S/C12H21ClN2OS/c1-10(2)15(5-3-7-16)6-4-12-14-11(8-13)9-17-12/h9-10,16H,3-8H2,1-2H3 |
| InChIKey | OIXKNEFZHKEHKA-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.83 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|