C13H14ClFN2S — CID 61413078
N-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-1-(4-fluorophenyl)-N-methylmethanamine (PubChem CID 61413078) has the molecular formula C13H14ClFN2S and a molecular weight of 284.79 g/mol. Its IUPAC name is N-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-1-(4-fluorophenyl)-N-methylmethanamine.
| Compound Name | N-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-1-(4-fluorophenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 61413078 |
| Molecular Formula | C13H14ClFN2S |
| Molecular Weight | 284.79 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | N-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-1-(4-fluorophenyl)-N-methylmethanamine |
| SMILES | CN(Cc1ccc(F)cc1)Cc1nc(CCl)cs1 |
| InChI | InChI=1S/C13H14ClFN2S/c1-17(7-10-2-4-11(15)5-3-10)8-13-16-12(6-14)9-18-13/h2-5,9H,6-8H2,1H3 |
| InChIKey | PVXSAHTWCMOJLS-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.79 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|