C11H19ClN2S — CID 61428998
N-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-N,3-dimethylbutan-1-amine (PubChem CID 61428998) has the molecular formula C11H19ClN2S and a molecular weight of 246.81 g/mol. Its IUPAC name is N-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-N,3-dimethylbutan-1-amine.
| Compound Name | N-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-N,3-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 61428998 |
| Molecular Formula | C11H19ClN2S |
| Molecular Weight | 246.81 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | N-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-N,3-dimethylbutan-1-amine |
| SMILES | CC(C)CCN(C)Cc1nc(CCl)cs1 |
| InChI | InChI=1S/C11H19ClN2S/c1-9(2)4-5-14(3)7-11-13-10(6-12)8-15-11/h8-9H,4-7H2,1-3H3 |
| InChIKey | WEDDDRXFDULFQM-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.81 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|