C10H17ClN2S2 — CID 112663022
N-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-N-methyl-1-methylsulfanylpropan-2-amine (PubChem CID 112663022) has the molecular formula C10H17ClN2S2 and a molecular weight of 264.85 g/mol. Its IUPAC name is N-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-N-methyl-1-methylsulfanylpropan-2-amine.
| Compound Name | N-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-N-methyl-1-methylsulfanylpropan-2-amine |
|---|---|
| PubChem CID | 112663022 |
| Molecular Formula | C10H17ClN2S2 |
| Molecular Weight | 264.85 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | N-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-N-methyl-1-methylsulfanylpropan-2-amine |
| SMILES | CSCC(C)N(C)Cc1nc(CCl)cs1 |
| InChI | InChI=1S/C10H17ClN2S2/c1-8(6-14-3)13(2)5-10-12-9(4-11)7-15-10/h7-8H,4-6H2,1-3H3 |
| InChIKey | ZFSNLNCKBAPUIR-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.85 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|