C10H17ClN2OS — CID 79390196
1-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl-methylamino]-2-methylpropan-2-ol (PubChem CID 79390196) has the molecular formula C10H17ClN2OS and a molecular weight of 248.78 g/mol. Its IUPAC name is 1-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl-methylamino]-2-methylpropan-2-ol.
| Compound Name | 1-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl-methylamino]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 79390196 |
| Molecular Formula | C10H17ClN2OS |
| Molecular Weight | 248.78 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 1-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl-methylamino]-2-methylpropan-2-ol |
| SMILES | CN(Cc1nc(CCl)cs1)CC(C)(C)O |
| InChI | InChI=1S/C10H17ClN2OS/c1-10(2,14)7-13(3)5-9-12-8(4-11)6-15-9/h6,14H,4-5,7H2,1-3H3 |
| InChIKey | APCVXFWZCCCJNM-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.78 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|