C13H14BrClN2S — CID 61416017
1-(3-bromophenyl)-N-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-N-methylmethanamine (PubChem CID 61416017) has the molecular formula C13H14BrClN2S and a molecular weight of 345.69 g/mol. Its IUPAC name is 1-(3-bromophenyl)-N-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-N-methylmethanamine.
| Compound Name | 1-(3-bromophenyl)-N-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 61416017 |
| Molecular Formula | C13H14BrClN2S |
| Molecular Weight | 345.69 g/mol |
| Exact Mass | 343.97 |
| IUPAC Name | 1-(3-bromophenyl)-N-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-N-methylmethanamine |
| SMILES | CN(Cc1cccc(Br)c1)Cc1nc(CCl)cs1 |
| InChI | InChI=1S/C13H14BrClN2S/c1-17(7-10-3-2-4-11(14)5-10)8-13-16-12(6-15)9-18-13/h2-5,9H,6-8H2,1H3 |
| InChIKey | DIXVGTCYYISAMT-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.69 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|