C15H17BrClNOS — CID 82823971
2-[4-[(3-bromophenyl)methoxy]butyl]-4-(chloromethyl)-1,3-thiazole (PubChem CID 82823971) has the molecular formula C15H17BrClNOS and a molecular weight of 374.73 g/mol. Its IUPAC name is 2-[4-[(3-bromophenyl)methoxy]butyl]-4-(chloromethyl)-1,3-thiazole.
| Compound Name | 2-[4-[(3-bromophenyl)methoxy]butyl]-4-(chloromethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 82823971 |
| Molecular Formula | C15H17BrClNOS |
| Molecular Weight | 374.73 g/mol |
| Exact Mass | 372.99 |
| IUPAC Name | 2-[4-[(3-bromophenyl)methoxy]butyl]-4-(chloromethyl)-1,3-thiazole |
| SMILES | ClCc1csc(CCCCOCc2cccc(Br)c2)n1 |
| InChI | InChI=1S/C15H17BrClNOS/c16-13-5-3-4-12(8-13)10-19-7-2-1-6-15-18-14(9-17)11-20-15/h3-5,8,11H,1-2,6-7,9-10H2 |
| InChIKey | QCSBCPWTFLZZFR-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.73 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|