C15H17ClFNOS — CID 63935946
4-(chloromethyl)-2-[4-[(2-fluorophenyl)methoxy]butyl]-1,3-thiazole (PubChem CID 63935946) has the molecular formula C15H17ClFNOS and a molecular weight of 313.82 g/mol. Its IUPAC name is 4-(chloromethyl)-2-[4-[(2-fluorophenyl)methoxy]butyl]-1,3-thiazole.
| Compound Name | 4-(chloromethyl)-2-[4-[(2-fluorophenyl)methoxy]butyl]-1,3-thiazole |
|---|---|
| PubChem CID | 63935946 |
| Molecular Formula | C15H17ClFNOS |
| Molecular Weight | 313.82 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 4-(chloromethyl)-2-[4-[(2-fluorophenyl)methoxy]butyl]-1,3-thiazole |
| SMILES | Fc1ccccc1COCCCCc1nc(CCl)cs1 |
| InChI | InChI=1S/C15H17ClFNOS/c16-9-13-11-20-15(18-13)7-3-4-8-19-10-12-5-1-2-6-14(12)17/h1-2,5-6,11H,3-4,7-10H2 |
| InChIKey | HXENFEKVTLQTGR-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.82 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|