C13H23ClN2S — CID 61428899
N-[3-[4-(chloromethyl)-1,3-thiazol-2-yl]propyl]-N,3-dimethylbutan-1-amine (PubChem CID 61428899) has the molecular formula C13H23ClN2S and a molecular weight of 274.86 g/mol. Its IUPAC name is N-[3-[4-(chloromethyl)-1,3-thiazol-2-yl]propyl]-N,3-dimethylbutan-1-amine.
| Compound Name | N-[3-[4-(chloromethyl)-1,3-thiazol-2-yl]propyl]-N,3-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 61428899 |
| Molecular Formula | C13H23ClN2S |
| Molecular Weight | 274.86 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | N-[3-[4-(chloromethyl)-1,3-thiazol-2-yl]propyl]-N,3-dimethylbutan-1-amine |
| SMILES | CC(C)CCN(C)CCCc1nc(CCl)cs1 |
| InChI | InChI=1S/C13H23ClN2S/c1-11(2)6-8-16(3)7-4-5-13-15-12(9-14)10-17-13/h10-11H,4-9H2,1-3H3 |
| InChIKey | ICLREFFZHDYSLK-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.86 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|