C14H21ClN2OS — CID 103500682
2-[4-(chloromethyl)-1,3-thiazol-2-yl]-1-(4-propan-2-ylpiperidin-1-yl)ethanone (PubChem CID 103500682) has the molecular formula C14H21ClN2OS and a molecular weight of 300.86 g/mol. Its IUPAC name is 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-1-(4-propan-2-ylpiperidin-1-yl)ethanone.
| Compound Name | 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-1-(4-propan-2-ylpiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 103500682 |
| Molecular Formula | C14H21ClN2OS |
| Molecular Weight | 300.86 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-1-(4-propan-2-ylpiperidin-1-yl)ethanone |
| SMILES | CC(C)C1CCN(C(=O)Cc2nc(CCl)cs2)CC1 |
| InChI | InChI=1S/C14H21ClN2OS/c1-10(2)11-3-5-17(6-4-11)14(18)7-13-16-12(8-15)9-19-13/h9-11H,3-8H2,1-2H3 |
| InChIKey | KPTMHZLFQFOGDE-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.86 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|