C14H23ClN4OS — CID 62888535
2-[4-(chloromethyl)-1,3-thiazol-2-yl]-1-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]ethanone (PubChem CID 62888535) has the molecular formula C14H23ClN4OS and a molecular weight of 330.89 g/mol. Its IUPAC name is 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-1-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]ethanone.
| Compound Name | 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-1-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 62888535 |
| Molecular Formula | C14H23ClN4OS |
| Molecular Weight | 330.89 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-1-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]ethanone |
| SMILES | CN(C)CCN1CCN(C(=O)Cc2nc(CCl)cs2)CC1 |
| InChI | InChI=1S/C14H23ClN4OS/c1-17(2)3-4-18-5-7-19(8-6-18)14(20)9-13-16-12(10-15)11-21-13/h11H,3-10H2,1-2H3 |
| InChIKey | CIFAXYHFZYZEJV-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.89 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|