C9H16N2OS — CID 102981948
4-(pentan-2-yloxymethyl)-1,3-thiazol-2-amine (PubChem CID 102981948) has the molecular formula C9H16N2OS and a molecular weight of 200.31 g/mol. Its IUPAC name is 4-(pentan-2-yloxymethyl)-1,3-thiazol-2-amine.
| Compound Name | 4-(pentan-2-yloxymethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 102981948 |
| Molecular Formula | C9H16N2OS |
| Molecular Weight | 200.31 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 4-(pentan-2-yloxymethyl)-1,3-thiazol-2-amine |
| SMILES | CCCC(C)OCc1csc(N)n1 |
| InChI | InChI=1S/C9H16N2OS/c1-3-4-7(2)12-5-8-6-13-9(10)11-8/h6-7H,3-5H2,1-2H3,(H2,10,11) |
| InChIKey | GFSGHPCMPHAPAE-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.31 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |