C12H23N3S — CID 65485245
4-[2-(heptan-2-ylamino)ethyl]-1,3-thiazol-2-amine (PubChem CID 65485245) has the molecular formula C12H23N3S and a molecular weight of 241.40 g/mol. Its IUPAC name is 4-[2-(heptan-2-ylamino)ethyl]-1,3-thiazol-2-amine.
| Compound Name | 4-[2-(heptan-2-ylamino)ethyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 65485245 |
| Molecular Formula | C12H23N3S |
| Molecular Weight | 241.40 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | 4-[2-(heptan-2-ylamino)ethyl]-1,3-thiazol-2-amine |
| SMILES | CCCCCC(C)NCCc1csc(N)n1 |
| InChI | InChI=1S/C12H23N3S/c1-3-4-5-6-10(2)14-8-7-11-9-16-12(13)15-11/h9-10,14H,3-8H2,1-2H3,(H2,13,15) |
| InChIKey | PDEOOWPTJZGOLV-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.40 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|