C12H18ClN3S — CID 174616600
4-butyl-1,3-thiazol-2-amine;pyridine;hydrochloride (PubChem CID 174616600) has the molecular formula C12H18ClN3S and a molecular weight of 271.82 g/mol. Its IUPAC name is 4-butyl-1,3-thiazol-2-amine;pyridine;hydrochloride.
| Compound Name | 4-butyl-1,3-thiazol-2-amine;pyridine;hydrochloride |
|---|---|
| PubChem CID | 174616600 |
| Molecular Formula | C12H18ClN3S |
| Molecular Weight | 271.82 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 4-butyl-1,3-thiazol-2-amine;pyridine;hydrochloride |
| SMILES | CCCCc1csc(N)n1.Cl.c1ccncc1 |
| InChI | InChI=1S/C7H12N2S.C5H5N.ClH/c1-2-3-4-6-5-10-7(8)9-6;1-2-4-6-5-3-1;/h5H,2-4H2,1H3,(H2,8,9);1-5H;1H |
| InChIKey | LLCVKQHHAMSHQI-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.82 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |