C14H20N2S — CID 174630641
4-butyl-1,3-thiazol-2-amine;toluene (PubChem CID 174630641) has the molecular formula C14H20N2S and a molecular weight of 248.40 g/mol. Its IUPAC name is 4-butyl-1,3-thiazol-2-amine;toluene.
| Compound Name | 4-butyl-1,3-thiazol-2-amine;toluene |
|---|---|
| PubChem CID | 174630641 |
| Molecular Formula | C14H20N2S |
| Molecular Weight | 248.40 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 4-butyl-1,3-thiazol-2-amine;toluene |
| SMILES | CCCCc1csc(N)n1.Cc1ccccc1 |
| InChI | InChI=1S/C7H12N2S.C7H8/c1-2-3-4-6-5-10-7(8)9-6;1-7-5-3-2-4-6-7/h5H,2-4H2,1H3,(H2,8,9);2-6H,1H3 |
| InChIKey | YGGGVLOWHDULMI-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.40 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |