C5H7FN2S — CID 83854193
4-(2-fluoroethyl)-1,3-thiazol-2-amine (PubChem CID 83854193) has the molecular formula C5H7FN2S and a molecular weight of 146.19 g/mol. Its IUPAC name is 4-(2-fluoroethyl)-1,3-thiazol-2-amine.
| Compound Name | 4-(2-fluoroethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 83854193 |
| Molecular Formula | C5H7FN2S |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.03 |
| IUPAC Name | 4-(2-fluoroethyl)-1,3-thiazol-2-amine |
| SMILES | Nc1nc(CCF)cs1 |
| InChI | InChI=1S/C5H7FN2S/c6-2-1-4-3-9-5(7)8-4/h3H,1-2H2,(H2,7,8) |
| InChIKey | BKPGBHSEUFRSQH-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |