C8H12N2S — CID 127017249
4-(2-cyclopropylethyl)-1,3-thiazol-2-amine (PubChem CID 127017249) has the molecular formula C8H12N2S and a molecular weight of 168.26 g/mol. Its IUPAC name is 4-(2-cyclopropylethyl)-1,3-thiazol-2-amine.
| Compound Name | 4-(2-cyclopropylethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 127017249 |
| Molecular Formula | C8H12N2S |
| Molecular Weight | 168.26 g/mol |
| Exact Mass | 168.07 |
| IUPAC Name | 4-(2-cyclopropylethyl)-1,3-thiazol-2-amine |
| SMILES | Nc1nc(CCC2CC2)cs1 |
| InChI | InChI=1S/C8H12N2S/c9-8-10-7(5-11-8)4-3-6-1-2-6/h5-6H,1-4H2,(H2,9,10) |
| InChIKey | QELZMJKOWCPONG-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.26 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |