C14H23N3S — CID 65483873
4-[2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)ethyl]-1,3-thiazol-2-amine (PubChem CID 65483873) has the molecular formula C14H23N3S and a molecular weight of 265.43 g/mol. Its IUPAC name is 4-[2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)ethyl]-1,3-thiazol-2-amine.
| Compound Name | 4-[2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)ethyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 65483873 |
| Molecular Formula | C14H23N3S |
| Molecular Weight | 265.43 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | 4-[2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)ethyl]-1,3-thiazol-2-amine |
| SMILES | Nc1nc(CCN2CCCC3CCCCC32)cs1 |
| InChI | InChI=1S/C14H23N3S/c15-14-16-12(10-18-14)7-9-17-8-3-5-11-4-1-2-6-13(11)17/h10-11,13H,1-9H2,(H2,15,16) |
| InChIKey | YDPKGEGODJEXCW-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.43 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |