C12H21N3S2 — CID 13363924
4-[2-(2-methylpiperidin-1-yl)ethylsulfanylmethyl]-1,3-thiazol-2-amine (PubChem CID 13363924) has the molecular formula C12H21N3S2 and a molecular weight of 271.45 g/mol. Its IUPAC name is 4-[2-(2-methylpiperidin-1-yl)ethylsulfanylmethyl]-1,3-thiazol-2-amine.
| Compound Name | 4-[2-(2-methylpiperidin-1-yl)ethylsulfanylmethyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 13363924 |
| Molecular Formula | C12H21N3S2 |
| Molecular Weight | 271.45 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 4-[2-(2-methylpiperidin-1-yl)ethylsulfanylmethyl]-1,3-thiazol-2-amine |
| SMILES | CC1CCCCN1CCSCc1csc(N)n1 |
| InChI | InChI=1S/C12H21N3S2/c1-10-4-2-3-5-15(10)6-7-16-8-11-9-17-12(13)14-11/h9-10H,2-8H2,1H3,(H2,13,14) |
| InChIKey | ZWNRHYPUUBKYDG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.45 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|