C20H29N5OS — CID 125179187
1-[3-(2-amino-1,3-thiazol-4-yl)propyl]-3-[3-[[(2S)-2-methylpiperidin-1-yl]methyl]phenyl]urea (PubChem CID 125179187) has the molecular formula C20H29N5OS and a molecular weight of 387.55 g/mol. Its IUPAC name is 1-[3-(2-amino-1,3-thiazol-4-yl)propyl]-3-[3-[[(2S)-2-methylpiperidin-1-yl]methyl]phenyl]urea.
| Compound Name | 1-[3-(2-amino-1,3-thiazol-4-yl)propyl]-3-[3-[[(2S)-2-methylpiperidin-1-yl]methyl]phenyl]urea |
|---|---|
| PubChem CID | 125179187 |
| Molecular Formula | C20H29N5OS |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | 1-[3-(2-amino-1,3-thiazol-4-yl)propyl]-3-[3-[[(2S)-2-methylpiperidin-1-yl]methyl]phenyl]urea |
| SMILES | C[C@H]1CCCCN1Cc1cccc(NC(=O)NCCCc2csc(N)n2)c1 |
| InChI | InChI=1S/C20H29N5OS/c1-15-6-2-3-11-25(15)13-16-7-4-8-17(12-16)24-20(26)22-10-5-9-18-14-27-19(21)23-18/h4,7-8,12,14-15H,2-3,5-6,9-11,13H2,1H3,(H2,21,23)(H2,22,24,26)/t15-/m0/s1 |
| InChIKey | ZJFNPJQNJVYFDG-HNNXBMFYSA-N |
| XLogP | 3.85 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|