C18H23N5O2S — CID 97434234
1-[3-(2-amino-1,3-thiazol-4-yl)propyl]-3-[3-[(2R)-2-methyl-5-oxopyrrolidin-1-yl]phenyl]urea (PubChem CID 97434234) has the molecular formula C18H23N5O2S and a molecular weight of 373.48 g/mol. Its IUPAC name is 1-[3-(2-amino-1,3-thiazol-4-yl)propyl]-3-[3-[(2R)-2-methyl-5-oxopyrrolidin-1-yl]phenyl]urea.
| Compound Name | 1-[3-(2-amino-1,3-thiazol-4-yl)propyl]-3-[3-[(2R)-2-methyl-5-oxopyrrolidin-1-yl]phenyl]urea |
|---|---|
| PubChem CID | 97434234 |
| Molecular Formula | C18H23N5O2S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 1-[3-(2-amino-1,3-thiazol-4-yl)propyl]-3-[3-[(2R)-2-methyl-5-oxopyrrolidin-1-yl]phenyl]urea |
| SMILES | C[C@@H]1CCC(=O)N1c1cccc(NC(=O)NCCCc2csc(N)n2)c1 |
| InChI | InChI=1S/C18H23N5O2S/c1-12-7-8-16(24)23(12)15-6-2-4-13(10-15)22-18(25)20-9-3-5-14-11-26-17(19)21-14/h2,4,6,10-12H,3,5,7-9H2,1H3,(H2,19,21)(H2,20,22,25)/t12-/m1/s1 |
| InChIKey | MADPCSZCFAGGAV-GFCCVEGCSA-N |
| XLogP | 2.99 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|