C14H23N3O3S — CID 135091405
(1R,3R,4S)-N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-4-hydroxy-3-methoxycyclohexane-1-carboxamide (PubChem CID 135091405) has the molecular formula C14H23N3O3S and a molecular weight of 313.42 g/mol. Its IUPAC name is (1R,3R,4S)-N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-4-hydroxy-3-methoxycyclohexane-1-carboxamide.
| Compound Name | (1R,3R,4S)-N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-4-hydroxy-3-methoxycyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 135091405 |
| Molecular Formula | C14H23N3O3S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | (1R,3R,4S)-N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-4-hydroxy-3-methoxycyclohexane-1-carboxamide |
| SMILES | CO[C@@H]1C[C@H](C(=O)NCCCc2csc(N)n2)CC[C@@H]1O |
| InChI | InChI=1S/C14H23N3O3S/c1-20-12-7-9(4-5-11(12)18)13(19)16-6-2-3-10-8-21-14(15)17-10/h8-9,11-12,18H,2-7H2,1H3,(H2,15,17)(H,16,19)/t9-,11+,12-/m1/s1 |
| InChIKey | IMOVNSKHTWWRBF-ADEWGFFLSA-N |
| XLogP | 0.95 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|