C18H27NO4 — CID 135114422
(1R,3R,4S)-4-hydroxy-3-methoxy-N-[3-(3-methoxyphenyl)propyl]cyclohexane-1-carboxamide (PubChem CID 135114422) has the molecular formula C18H27NO4 and a molecular weight of 321.42 g/mol. Its IUPAC name is (1R,3R,4S)-4-hydroxy-3-methoxy-N-[3-(3-methoxyphenyl)propyl]cyclohexane-1-carboxamide.
| Compound Name | (1R,3R,4S)-4-hydroxy-3-methoxy-N-[3-(3-methoxyphenyl)propyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 135114422 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | (1R,3R,4S)-4-hydroxy-3-methoxy-N-[3-(3-methoxyphenyl)propyl]cyclohexane-1-carboxamide |
| SMILES | COc1cccc(CCCNC(=O)[C@@H]2CC[C@H](O)[C@H](OC)C2)c1 |
| InChI | InChI=1S/C18H27NO4/c1-22-15-7-3-5-13(11-15)6-4-10-19-18(21)14-8-9-16(20)17(12-14)23-2/h3,5,7,11,14,16-17,20H,4,6,8-10,12H2,1-2H3,(H,19,21)/t14-,16+,17-/m1/s1 |
| InChIKey | ZJFLYLTUSPXDAA-HYVNUMGLSA-N |
| XLogP | 1.92 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|