C14H21ClN2O2S — CID 119316856
N-[3-(3-methoxyphenyl)propyl]-1,3-thiazolidine-4-carboxamide;hydrochloride (PubChem CID 119316856) has the molecular formula C14H21ClN2O2S and a molecular weight of 316.85 g/mol. Its IUPAC name is N-[3-(3-methoxyphenyl)propyl]-1,3-thiazolidine-4-carboxamide;hydrochloride.
| Compound Name | N-[3-(3-methoxyphenyl)propyl]-1,3-thiazolidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119316856 |
| Molecular Formula | C14H21ClN2O2S |
| Molecular Weight | 316.85 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | N-[3-(3-methoxyphenyl)propyl]-1,3-thiazolidine-4-carboxamide;hydrochloride |
| SMILES | COc1cccc(CCCNC(=O)C2CSCN2)c1.Cl |
| InChI | InChI=1S/C14H20N2O2S.ClH/c1-18-12-6-2-4-11(8-12)5-3-7-15-14(17)13-9-19-10-16-13;/h2,4,6,8,13,16H,3,5,7,9-10H2,1H3,(H,15,17);1H |
| InChIKey | IEPKVHXGMTUHBN-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.85 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|