C18H21ClN4O3S — CID 131920666
N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-1-(3-chloro-4-methoxyphenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 131920666) has the molecular formula C18H21ClN4O3S and a molecular weight of 408.91 g/mol. Its IUPAC name is N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-1-(3-chloro-4-methoxyphenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-1-(3-chloro-4-methoxyphenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 131920666 |
| Molecular Formula | C18H21ClN4O3S |
| Molecular Weight | 408.91 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-1-(3-chloro-4-methoxyphenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | COc1ccc(N2CC(C(=O)NCCCc3csc(N)n3)CC2=O)cc1Cl |
| InChI | InChI=1S/C18H21ClN4O3S/c1-26-15-5-4-13(8-14(15)19)23-9-11(7-16(23)24)17(25)21-6-2-3-12-10-27-18(20)22-12/h4-5,8,10-11H,2-3,6-7,9H2,1H3,(H2,20,22)(H,21,25) |
| InChIKey | MGQMDVMRYHNBJR-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.91 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|