C18H23ClN2O4 — CID 97137882
(3R)-1-(3-chloro-4-methoxyphenyl)-N-(oxan-4-ylmethyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 97137882) has the molecular formula C18H23ClN2O4 and a molecular weight of 366.85 g/mol. Its IUPAC name is (3R)-1-(3-chloro-4-methoxyphenyl)-N-(oxan-4-ylmethyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R)-1-(3-chloro-4-methoxyphenyl)-N-(oxan-4-ylmethyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 97137882 |
| Molecular Formula | C18H23ClN2O4 |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | (3R)-1-(3-chloro-4-methoxyphenyl)-N-(oxan-4-ylmethyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | COc1ccc(N2C[C@H](C(=O)NCC3CCOCC3)CC2=O)cc1Cl |
| InChI | InChI=1S/C18H23ClN2O4/c1-24-16-3-2-14(9-15(16)19)21-11-13(8-17(21)22)18(23)20-10-12-4-6-25-7-5-12/h2-3,9,12-13H,4-8,10-11H2,1H3,(H,20,23)/t13-/m1/s1 |
| InChIKey | MFVTZEQQVDSWHX-CYBMUJFWSA-N |
| XLogP | 2.24 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |