C22H30N4O — CID 72848016
1-methyl-3-[3-[(2-methylpiperidin-1-yl)methyl]phenyl]-1-(2-pyridin-2-ylethyl)urea (PubChem CID 72848016) has the molecular formula C22H30N4O and a molecular weight of 366.51 g/mol. Its IUPAC name is 1-methyl-3-[3-[(2-methylpiperidin-1-yl)methyl]phenyl]-1-(2-pyridin-2-ylethyl)urea.
| Compound Name | 1-methyl-3-[3-[(2-methylpiperidin-1-yl)methyl]phenyl]-1-(2-pyridin-2-ylethyl)urea |
|---|---|
| PubChem CID | 72848016 |
| Molecular Formula | C22H30N4O |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | 1-methyl-3-[3-[(2-methylpiperidin-1-yl)methyl]phenyl]-1-(2-pyridin-2-ylethyl)urea |
| SMILES | CC1CCCCN1Cc1cccc(NC(=O)N(C)CCc2ccccn2)c1 |
| InChI | InChI=1S/C22H30N4O/c1-18-8-4-6-14-26(18)17-19-9-7-11-21(16-19)24-22(27)25(2)15-12-20-10-3-5-13-23-20/h3,5,7,9-11,13,16,18H,4,6,8,12,14-15,17H2,1-2H3,(H,24,27) |
| InChIKey | IBLBSEJBNUEPSN-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |