C20H25N3O3S — CID 86988743
3-(4-cyclopentylsulfonylphenyl)-1-methyl-1-(2-pyridin-2-ylethyl)urea (PubChem CID 86988743) has the molecular formula C20H25N3O3S and a molecular weight of 387.51 g/mol. Its IUPAC name is 3-(4-cyclopentylsulfonylphenyl)-1-methyl-1-(2-pyridin-2-ylethyl)urea.
| Compound Name | 3-(4-cyclopentylsulfonylphenyl)-1-methyl-1-(2-pyridin-2-ylethyl)urea |
|---|---|
| PubChem CID | 86988743 |
| Molecular Formula | C20H25N3O3S |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 3-(4-cyclopentylsulfonylphenyl)-1-methyl-1-(2-pyridin-2-ylethyl)urea |
| SMILES | CN(CCc1ccccn1)C(=O)Nc1ccc(S(=O)(=O)C2CCCC2)cc1 |
| InChI | InChI=1S/C20H25N3O3S/c1-23(15-13-16-6-4-5-14-21-16)20(24)22-17-9-11-19(12-10-17)27(25,26)18-7-2-3-8-18/h4-6,9-12,14,18H,2-3,7-8,13,15H2,1H3,(H,22,24) |
| InChIKey | QRPIBJKTNURAON-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |