C18H24N4O3S — CID 47489615
1-methyl-3-[4-[methyl(propan-2-yl)sulfamoyl]phenyl]-1-(pyridin-2-ylmethyl)urea (PubChem CID 47489615) has the molecular formula C18H24N4O3S and a molecular weight of 376.48 g/mol. Its IUPAC name is 1-methyl-3-[4-[methyl(propan-2-yl)sulfamoyl]phenyl]-1-(pyridin-2-ylmethyl)urea.
| Compound Name | 1-methyl-3-[4-[methyl(propan-2-yl)sulfamoyl]phenyl]-1-(pyridin-2-ylmethyl)urea |
|---|---|
| PubChem CID | 47489615 |
| Molecular Formula | C18H24N4O3S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 1-methyl-3-[4-[methyl(propan-2-yl)sulfamoyl]phenyl]-1-(pyridin-2-ylmethyl)urea |
| SMILES | CC(C)N(C)S(=O)(=O)c1ccc(NC(=O)N(C)Cc2ccccn2)cc1 |
| InChI | InChI=1S/C18H24N4O3S/c1-14(2)22(4)26(24,25)17-10-8-15(9-11-17)20-18(23)21(3)13-16-7-5-6-12-19-16/h5-12,14H,13H2,1-4H3,(H,20,23) |
| InChIKey | KJWWAVUXSJYXEG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |