C19H22N4O2 — CID 47490267
1-methyl-1-(pyridin-2-ylmethyl)-3-[4-(pyrrolidine-1-carbonyl)phenyl]urea (PubChem CID 47490267) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is 1-methyl-1-(pyridin-2-ylmethyl)-3-[4-(pyrrolidine-1-carbonyl)phenyl]urea.
| Compound Name | 1-methyl-1-(pyridin-2-ylmethyl)-3-[4-(pyrrolidine-1-carbonyl)phenyl]urea |
|---|---|
| PubChem CID | 47490267 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 1-methyl-1-(pyridin-2-ylmethyl)-3-[4-(pyrrolidine-1-carbonyl)phenyl]urea |
| SMILES | CN(Cc1ccccn1)C(=O)Nc1ccc(C(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C19H22N4O2/c1-22(14-17-6-2-3-11-20-17)19(25)21-16-9-7-15(8-10-16)18(24)23-12-4-5-13-23/h2-3,6-11H,4-5,12-14H2,1H3,(H,21,25) |
| InChIKey | YLBDHQDRUZQSTF-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |