C19H29N3O3S — CID 97348237
(3S)-1-(cyclopentanecarbonyl)-N-methyl-N-(2-pyridin-2-ylethyl)piperidine-3-sulfonamide (PubChem CID 97348237) has the molecular formula C19H29N3O3S and a molecular weight of 379.53 g/mol. Its IUPAC name is (3S)-1-(cyclopentanecarbonyl)-N-methyl-N-(2-pyridin-2-ylethyl)piperidine-3-sulfonamide.
| Compound Name | (3S)-1-(cyclopentanecarbonyl)-N-methyl-N-(2-pyridin-2-ylethyl)piperidine-3-sulfonamide |
|---|---|
| PubChem CID | 97348237 |
| Molecular Formula | C19H29N3O3S |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | (3S)-1-(cyclopentanecarbonyl)-N-methyl-N-(2-pyridin-2-ylethyl)piperidine-3-sulfonamide |
| SMILES | CN(CCc1ccccn1)S(=O)(=O)[C@H]1CCCN(C(=O)C2CCCC2)C1 |
| InChI | InChI=1S/C19H29N3O3S/c1-21(14-11-17-9-4-5-12-20-17)26(24,25)18-10-6-13-22(15-18)19(23)16-7-2-3-8-16/h4-5,9,12,16,18H,2-3,6-8,10-11,13-15H2,1H3/t18-/m0/s1 |
| InChIKey | IYIIUCANHCFYEM-SFHVURJKSA-N |
| XLogP | 2.07 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |