C22H31N5O — CID 72895536
N-[3-[(2-methylpiperidin-1-yl)methyl]phenyl]-4-(1H-pyrazol-5-yl)piperidine-1-carboxamide (PubChem CID 72895536) has the molecular formula C22H31N5O and a molecular weight of 381.52 g/mol. Its IUPAC name is N-[3-[(2-methylpiperidin-1-yl)methyl]phenyl]-4-(1H-pyrazol-5-yl)piperidine-1-carboxamide.
| Compound Name | N-[3-[(2-methylpiperidin-1-yl)methyl]phenyl]-4-(1H-pyrazol-5-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 72895536 |
| Molecular Formula | C22H31N5O |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.25 |
| IUPAC Name | N-[3-[(2-methylpiperidin-1-yl)methyl]phenyl]-4-(1H-pyrazol-5-yl)piperidine-1-carboxamide |
| SMILES | CC1CCCCN1Cc1cccc(NC(=O)N2CCC(c3ccn[nH]3)CC2)c1 |
| InChI | InChI=1S/C22H31N5O/c1-17-5-2-3-12-27(17)16-18-6-4-7-20(15-18)24-22(28)26-13-9-19(10-14-26)21-8-11-23-25-21/h4,6-8,11,15,17,19H,2-3,5,9-10,12-14,16H2,1H3,(H,23,25)(H,24,28) |
| InChIKey | PVERKIKIRYWBSN-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 64.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |